C14H11Cl4O4P — CID 139464935
bis[(2,4-dichlorophenyl)-hydroxymethyl]phosphinic acid (PubChem CID 139464935) has the molecular formula C14H11Cl4O4P and a molecular weight of 416.02 g/mol. Its IUPAC name is bis[(2,4-dichlorophenyl)-hydroxymethyl]phosphinic acid.
| Compound Name | bis[(2,4-dichlorophenyl)-hydroxymethyl]phosphinic acid |
|---|---|
| PubChem CID | 139464935 |
| Molecular Formula | C14H11Cl4O4P |
| Molecular Weight | 416.02 g/mol |
| Exact Mass | 413.91 |
| IUPAC Name | bis[(2,4-dichlorophenyl)-hydroxymethyl]phosphinic acid |
| SMILES | O=P(O)(C(O)c1ccc(Cl)cc1Cl)C(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H11Cl4O4P/c15-7-1-3-9(11(17)5-7)13(19)23(21,22)14(20)10-4-2-8(16)6-12(10)18/h1-6,13-14,19-20H,(H,21,22) |
| InChIKey | SIFDFXJVYWAKOJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.02 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|