C27H43Cl2O4P — CID 98345031
(S)-(2,4-dichlorophenyl)-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-[(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]methanol (PubChem CID 98345031) has the molecular formula C27H43Cl2O4P and a molecular weight of 533.52 g/mol. Its IUPAC name is (S)-(2,4-dichlorophenyl)-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-[(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]methanol.
| Compound Name | (S)-(2,4-dichlorophenyl)-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-[(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]methanol |
|---|---|
| PubChem CID | 98345031 |
| Molecular Formula | C27H43Cl2O4P |
| Molecular Weight | 533.52 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | (S)-(2,4-dichlorophenyl)-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-[(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]methanol |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@H]1OP(=O)(O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)[C@H](O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H43Cl2O4P/c1-16(2)21-10-7-18(5)13-25(21)32-34(31,27(30)23-12-9-20(28)15-24(23)29)33-26-14-19(6)8-11-22(26)17(3)4/h9,12,15-19,21-22,25-27,30H,7-8,10-11,13-14H2,1-6H3/t18-,19+,21+,22-,25-,26-,27+,34?/m1/s1 |
| InChIKey | AJCRHBDURXXWFB-OUMGQCLNSA-N |
| XLogP | 9.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.52 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|