C18H24Cl2O3 — CID 53297550
(5-methyl-2-propan-2-ylcyclohexyl) 2-(2,4-dichlorophenoxy)acetate (PubChem CID 53297550) has the molecular formula C18H24Cl2O3 and a molecular weight of 359.29 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 53297550 |
| Molecular Formula | C18H24Cl2O3 |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(2,4-dichlorophenoxy)acetate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)COc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C18H24Cl2O3/c1-11(2)14-6-4-12(3)8-17(14)23-18(21)10-22-16-7-5-13(19)9-15(16)20/h5,7,9,11-12,14,17H,4,6,8,10H2,1-3H3 |
| InChIKey | PQKJVXHXYCKSGC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |