C18H25ClO2S — CID 45155655
(5-methyl-2-propan-2-ylcyclohexyl) 2-(4-chlorophenyl)sulfanylacetate (PubChem CID 45155655) has the molecular formula C18H25ClO2S and a molecular weight of 340.92 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-(4-chlorophenyl)sulfanylacetate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(4-chlorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 45155655 |
| Molecular Formula | C18H25ClO2S |
| Molecular Weight | 340.92 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(4-chlorophenyl)sulfanylacetate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)CSc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H25ClO2S/c1-12(2)16-9-4-13(3)10-17(16)21-18(20)11-22-15-7-5-14(19)6-8-15/h5-8,12-13,16-17H,4,9-11H2,1-3H3 |
| InChIKey | IQDPLIHISAQUOO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.92 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |