C17H25NO3S — CID 25390571
[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetate (PubChem CID 25390571) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetate.
| Compound Name | [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 25390571 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@@H]1OC(=O)CSc1cccc[n+]1[O-] |
| InChI | InChI=1S/C17H25NO3S/c1-12(2)14-8-7-13(3)10-15(14)21-17(19)11-22-16-6-4-5-9-18(16)20/h4-6,9,12-15H,7-8,10-11H2,1-3H3/t13-,14+,15+/m1/s1 |
| InChIKey | CJNYKFHESKKCEE-ILXRZTDVSA-N |
| XLogP | 3.42 |
| TPSA | 53.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|