C11H10Cl2O2 — CID 102374717
3-[(S)-(2,4-dichlorophenyl)-hydroxymethyl]but-3-en-2-one (PubChem CID 102374717) has the molecular formula C11H10Cl2O2 and a molecular weight of 245.10 g/mol. Its IUPAC name is 3-[(S)-(2,4-dichlorophenyl)-hydroxymethyl]but-3-en-2-one.
| Compound Name | 3-[(S)-(2,4-dichlorophenyl)-hydroxymethyl]but-3-en-2-one |
|---|---|
| PubChem CID | 102374717 |
| Molecular Formula | C11H10Cl2O2 |
| Molecular Weight | 245.10 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 3-[(S)-(2,4-dichlorophenyl)-hydroxymethyl]but-3-en-2-one |
| SMILES | C=C(C(C)=O)[C@H](O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H10Cl2O2/c1-6(7(2)14)11(15)9-4-3-8(12)5-10(9)13/h3-5,11,15H,1H2,2H3/t11-/m0/s1 |
| InChIKey | VORVHKZWVMCTFM-NSHDSACASA-N |
| XLogP | 3.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.10 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|