C10H9Cl2NO2 — CID 101435730
2-[(2,4-dichlorophenyl)-hydroxymethyl]prop-2-enamide (PubChem CID 101435730) has the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)-hydroxymethyl]prop-2-enamide.
| Compound Name | 2-[(2,4-dichlorophenyl)-hydroxymethyl]prop-2-enamide |
|---|---|
| PubChem CID | 101435730 |
| Molecular Formula | C10H9Cl2NO2 |
| Molecular Weight | 246.09 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)-hydroxymethyl]prop-2-enamide |
| SMILES | C=C(C(N)=O)C(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H9Cl2NO2/c1-5(10(13)15)9(14)7-3-2-6(11)4-8(7)12/h2-4,9,14H,1H2,(H2,13,15) |
| InChIKey | GAHMDQJRRSEZAV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.09 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|