C8H5Cl2NO2 — CID 139220452
2-(2,5-dichlorophenyl)-2-oxoacetamide (PubChem CID 139220452) has the molecular formula C8H5Cl2NO2 and a molecular weight of 218.04 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-2-oxoacetamide.
| Compound Name | 2-(2,5-dichlorophenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 139220452 |
| Molecular Formula | C8H5Cl2NO2 |
| Molecular Weight | 218.04 g/mol |
| Exact Mass | 216.97 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-2-oxoacetamide |
| SMILES | NC(=O)C(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C8H5Cl2NO2/c9-4-1-2-6(10)5(3-4)7(12)8(11)13/h1-3H,(H2,11,13) |
| InChIKey | DRHCJYXFXRGCSK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.04 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|