C14H16Cl2N2O2 — CID 78903583
N-(1-carbamoylcyclohexyl)-2,5-dichlorobenzamide (PubChem CID 78903583) has the molecular formula C14H16Cl2N2O2 and a molecular weight of 315.20 g/mol. Its IUPAC name is N-(1-carbamoylcyclohexyl)-2,5-dichlorobenzamide.
| Compound Name | N-(1-carbamoylcyclohexyl)-2,5-dichlorobenzamide |
|---|---|
| PubChem CID | 78903583 |
| Molecular Formula | C14H16Cl2N2O2 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | N-(1-carbamoylcyclohexyl)-2,5-dichlorobenzamide |
| SMILES | NC(=O)C1(NC(=O)c2cc(Cl)ccc2Cl)CCCCC1 |
| InChI | InChI=1S/C14H16Cl2N2O2/c15-9-4-5-11(16)10(8-9)12(19)18-14(13(17)20)6-2-1-3-7-14/h4-5,8H,1-3,6-7H2,(H2,17,20)(H,18,19) |
| InChIKey | UKGLCJFHDHBOKS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |