C10H12Cl2N2O — CID 26602537
2-[[(1S)-1-(2,4-dichlorophenyl)ethyl]amino]acetamide (PubChem CID 26602537) has the molecular formula C10H12Cl2N2O and a molecular weight of 247.12 g/mol. Its IUPAC name is 2-[[(1S)-1-(2,4-dichlorophenyl)ethyl]amino]acetamide.
| Compound Name | 2-[[(1S)-1-(2,4-dichlorophenyl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 26602537 |
| Molecular Formula | C10H12Cl2N2O |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 2-[[(1S)-1-(2,4-dichlorophenyl)ethyl]amino]acetamide |
| SMILES | C[C@H](NCC(N)=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl2N2O/c1-6(14-5-10(13)15)8-3-2-7(11)4-9(8)12/h2-4,6,14H,5H2,1H3,(H2,13,15)/t6-/m0/s1 |
| InChIKey | ISHPXUDOHITYNA-LURJTMIESA-N |
| XLogP | 2.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |