C12H13Cl2NO2 — CID 103233973
2-[[1-(2,4-dichlorophenyl)ethylamino]methyl]prop-2-enoic acid (PubChem CID 103233973) has the molecular formula C12H13Cl2NO2 and a molecular weight of 274.15 g/mol. Its IUPAC name is 2-[[1-(2,4-dichlorophenyl)ethylamino]methyl]prop-2-enoic acid.
| Compound Name | 2-[[1-(2,4-dichlorophenyl)ethylamino]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103233973 |
| Molecular Formula | C12H13Cl2NO2 |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 2-[[1-(2,4-dichlorophenyl)ethylamino]methyl]prop-2-enoic acid |
| SMILES | C=C(CNC(C)c1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C12H13Cl2NO2/c1-7(12(16)17)6-15-8(2)10-4-3-9(13)5-11(10)14/h3-5,8,15H,1,6H2,2H3,(H,16,17) |
| InChIKey | ZENQYGJELRUNKL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|