C15H12Cl2O — CID 129362559
(1S)-1-(2,4-dichlorophenyl)-2-phenylprop-2-en-1-ol (PubChem CID 129362559) has the molecular formula C15H12Cl2O and a molecular weight of 279.17 g/mol. Its IUPAC name is (1S)-1-(2,4-dichlorophenyl)-2-phenylprop-2-en-1-ol.
| Compound Name | (1S)-1-(2,4-dichlorophenyl)-2-phenylprop-2-en-1-ol |
|---|---|
| PubChem CID | 129362559 |
| Molecular Formula | C15H12Cl2O |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | (1S)-1-(2,4-dichlorophenyl)-2-phenylprop-2-en-1-ol |
| SMILES | C=C(c1ccccc1)[C@H](O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl2O/c1-10(11-5-3-2-4-6-11)15(18)13-8-7-12(16)9-14(13)17/h2-9,15,18H,1H2/t15-/m0/s1 |
| InChIKey | SUBOIGQREGEHLI-HNNXBMFYSA-N |
| XLogP | 4.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |