C15H13Cl2N — CID 19817057
3-[3-(2,4-dichlorophenyl)but-1-en-2-yl]pyridine (PubChem CID 19817057) has the molecular formula C15H13Cl2N and a molecular weight of 278.18 g/mol. Its IUPAC name is 3-[3-(2,4-dichlorophenyl)but-1-en-2-yl]pyridine.
| Compound Name | 3-[3-(2,4-dichlorophenyl)but-1-en-2-yl]pyridine |
|---|---|
| PubChem CID | 19817057 |
| Molecular Formula | C15H13Cl2N |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 3-[3-(2,4-dichlorophenyl)but-1-en-2-yl]pyridine |
| SMILES | C=C(c1cccnc1)C(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H13Cl2N/c1-10(12-4-3-7-18-9-12)11(2)14-6-5-13(16)8-15(14)17/h3-9,11H,1H2,2H3 |
| InChIKey | SFKGHMTVZVVBIT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |