C17H12Cl3N — CID 19817063
3-[(Z)-1-chloro-3-(2,4-dichlorophenyl)hex-1-en-5-yn-2-yl]pyridine (PubChem CID 19817063) has the molecular formula C17H12Cl3N and a molecular weight of 336.65 g/mol. Its IUPAC name is 3-[(Z)-1-chloro-3-(2,4-dichlorophenyl)hex-1-en-5-yn-2-yl]pyridine.
| Compound Name | 3-[(Z)-1-chloro-3-(2,4-dichlorophenyl)hex-1-en-5-yn-2-yl]pyridine |
|---|---|
| PubChem CID | 19817063 |
| Molecular Formula | C17H12Cl3N |
| Molecular Weight | 336.65 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 3-[(Z)-1-chloro-3-(2,4-dichlorophenyl)hex-1-en-5-yn-2-yl]pyridine |
| SMILES | C#CCC(/C(=C/Cl)c1cccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H12Cl3N/c1-2-4-14(15-7-6-13(19)9-17(15)20)16(10-18)12-5-3-8-21-11-12/h1,3,5-11,14H,4H2/b16-10+ |
| InChIKey | HFOZKNMEXBZCNI-MHWRWJLKSA-N |
| XLogP | 5.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.65 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|