C19H24Cl2IN5O — CID 111310205
N-[2-[[[1-(2,4-dichlorophenyl)ethylamino]-(ethylamino)methylidene]amino]ethyl]pyridine-3-carboxamide;hydroiodide (PubChem CID 111310205) has the molecular formula C19H24Cl2IN5O and a molecular weight of 536.25 g/mol. Its IUPAC name is N-[2-[[[1-(2,4-dichlorophenyl)ethylamino]-(ethylamino)methylidene]amino]ethyl]pyridine-3-carboxamide;hydroiodide.
| Compound Name | N-[2-[[[1-(2,4-dichlorophenyl)ethylamino]-(ethylamino)methylidene]amino]ethyl]pyridine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111310205 |
| Molecular Formula | C19H24Cl2IN5O |
| Molecular Weight | 536.25 g/mol |
| Exact Mass | 535.04 |
| IUPAC Name | N-[2-[[[1-(2,4-dichlorophenyl)ethylamino]-(ethylamino)methylidene]amino]ethyl]pyridine-3-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)c1cccnc1)NC(C)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C19H23Cl2N5O.HI/c1-3-23-19(26-13(2)16-7-6-15(20)11-17(16)21)25-10-9-24-18(27)14-5-4-8-22-12-14;/h4-8,11-13H,3,9-10H2,1-2H3,(H,24,27)(H2,23,25,26);1H |
| InChIKey | HMLWSRLYMRNIIV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.25 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|