C19H16Cl2N2O — CID 70510374
2-(2,4-dichlorophenyl)-1,3-dipyridin-3-ylpropan-1-ol (PubChem CID 70510374) has the molecular formula C19H16Cl2N2O and a molecular weight of 359.26 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1,3-dipyridin-3-ylpropan-1-ol.
| Compound Name | 2-(2,4-dichlorophenyl)-1,3-dipyridin-3-ylpropan-1-ol |
|---|---|
| PubChem CID | 70510374 |
| Molecular Formula | C19H16Cl2N2O |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1,3-dipyridin-3-ylpropan-1-ol |
| SMILES | OC(c1cccnc1)C(Cc1cccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H16Cl2N2O/c20-15-5-6-16(18(21)10-15)17(9-13-3-1-7-22-11-13)19(24)14-4-2-8-23-12-14/h1-8,10-12,17,19,24H,9H2 |
| InChIKey | TZXHPWVBKPOTIR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |