C12H9Cl2N — CID 102311529
3-[(2,5-dichlorophenyl)methyl]pyridine (PubChem CID 102311529) has the molecular formula C12H9Cl2N and a molecular weight of 238.12 g/mol. Its IUPAC name is 3-[(2,5-dichlorophenyl)methyl]pyridine.
| Compound Name | 3-[(2,5-dichlorophenyl)methyl]pyridine |
|---|---|
| PubChem CID | 102311529 |
| Molecular Formula | C12H9Cl2N |
| Molecular Weight | 238.12 g/mol |
| Exact Mass | 237.01 |
| IUPAC Name | 3-[(2,5-dichlorophenyl)methyl]pyridine |
| SMILES | Clc1ccc(Cl)c(Cc2cccnc2)c1 |
| InChI | InChI=1S/C12H9Cl2N/c13-11-3-4-12(14)10(7-11)6-9-2-1-5-15-8-9/h1-5,7-8H,6H2 |
| InChIKey | SZAMKBQINPZSTO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.12 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |