C10H7Cl2N3 — CID 104737129
3,6-dichloro-4-(pyridin-3-ylmethyl)pyridazine (PubChem CID 104737129) has the molecular formula C10H7Cl2N3 and a molecular weight of 240.09 g/mol. Its IUPAC name is 3,6-dichloro-4-(pyridin-3-ylmethyl)pyridazine.
| Compound Name | 3,6-dichloro-4-(pyridin-3-ylmethyl)pyridazine |
|---|---|
| PubChem CID | 104737129 |
| Molecular Formula | C10H7Cl2N3 |
| Molecular Weight | 240.09 g/mol |
| Exact Mass | 239.00 |
| IUPAC Name | 3,6-dichloro-4-(pyridin-3-ylmethyl)pyridazine |
| SMILES | Clc1cc(Cc2cccnc2)c(Cl)nn1 |
| InChI | InChI=1S/C10H7Cl2N3/c11-9-5-8(10(12)15-14-9)4-7-2-1-3-13-6-7/h1-3,5-6H,4H2 |
| InChIKey | CAMGIFHAQVYFNJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.09 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |