C10H6Cl2FN3 — CID 80550393
4,6-dichloro-5-fluoro-2-(pyridin-3-ylmethyl)pyrimidine (PubChem CID 80550393) has the molecular formula C10H6Cl2FN3 and a molecular weight of 258.08 g/mol. Its IUPAC name is 4,6-dichloro-5-fluoro-2-(pyridin-3-ylmethyl)pyrimidine.
| Compound Name | 4,6-dichloro-5-fluoro-2-(pyridin-3-ylmethyl)pyrimidine |
|---|---|
| PubChem CID | 80550393 |
| Molecular Formula | C10H6Cl2FN3 |
| Molecular Weight | 258.08 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 4,6-dichloro-5-fluoro-2-(pyridin-3-ylmethyl)pyrimidine |
| SMILES | Fc1c(Cl)nc(Cc2cccnc2)nc1Cl |
| InChI | InChI=1S/C10H6Cl2FN3/c11-9-8(13)10(12)16-7(15-9)4-6-2-1-3-14-5-6/h1-3,5H,4H2 |
| InChIKey | YRZPLXAZFIRIJZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.08 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |