C9H10N6 — CID 112681587
6-(pyridin-3-ylmethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 112681587) has the molecular formula C9H10N6 and a molecular weight of 202.22 g/mol. Its IUPAC name is 6-(pyridin-3-ylmethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(pyridin-3-ylmethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 112681587 |
| Molecular Formula | C9H10N6 |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 6-(pyridin-3-ylmethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(Cc2cccnc2)n1 |
| InChI | InChI=1S/C9H10N6/c10-8-13-7(14-9(11)15-8)4-6-2-1-3-12-5-6/h1-3,5H,4H2,(H4,10,11,13,14,15) |
| InChIKey | XEHGTLMPOLKMDY-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |