C16H21N5 — CID 63868638
4-cycloheptyl-6-(pyridin-3-ylmethyl)-1,3,5-triazin-2-amine (PubChem CID 63868638) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is 4-cycloheptyl-6-(pyridin-3-ylmethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-cycloheptyl-6-(pyridin-3-ylmethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 63868638 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 4-cycloheptyl-6-(pyridin-3-ylmethyl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(Cc2cccnc2)nc(C2CCCCCC2)n1 |
| InChI | InChI=1S/C16H21N5/c17-16-20-14(10-12-6-5-9-18-11-12)19-15(21-16)13-7-3-1-2-4-8-13/h5-6,9,11,13H,1-4,7-8,10H2,(H2,17,19,20,21) |
| InChIKey | YKSRDYUIPAZKCV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |