C15H20N4S — CID 63867175
4-cycloheptyl-6-(thiophen-2-ylmethyl)-1,3,5-triazin-2-amine (PubChem CID 63867175) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is 4-cycloheptyl-6-(thiophen-2-ylmethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-cycloheptyl-6-(thiophen-2-ylmethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 63867175 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 4-cycloheptyl-6-(thiophen-2-ylmethyl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(Cc2cccs2)nc(C2CCCCCC2)n1 |
| InChI | InChI=1S/C15H20N4S/c16-15-18-13(10-12-8-5-9-20-12)17-14(19-15)11-6-3-1-2-4-7-11/h5,8-9,11H,1-4,6-7,10H2,(H2,16,17,18,19) |
| InChIKey | NRQIJGOIHVABGW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |