C16H20N4S — CID 65143794
4-cyclohexyl-6-(phenylsulfanylmethyl)-1,3,5-triazin-2-amine (PubChem CID 65143794) has the molecular formula C16H20N4S and a molecular weight of 300.43 g/mol. Its IUPAC name is 4-cyclohexyl-6-(phenylsulfanylmethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-cyclohexyl-6-(phenylsulfanylmethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 65143794 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 4-cyclohexyl-6-(phenylsulfanylmethyl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(CSc2ccccc2)nc(C2CCCCC2)n1 |
| InChI | InChI=1S/C16H20N4S/c17-16-19-14(11-21-13-9-5-2-6-10-13)18-15(20-16)12-7-3-1-4-8-12/h2,5-6,9-10,12H,1,3-4,7-8,11H2,(H2,17,18,19,20) |
| InChIKey | LUVBXVORJJIWDV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |