C16H19BrN4 — CID 63868061
4-[(4-bromophenyl)methyl]-6-cyclohexyl-1,3,5-triazin-2-amine (PubChem CID 63868061) has the molecular formula C16H19BrN4 and a molecular weight of 347.26 g/mol. Its IUPAC name is 4-[(4-bromophenyl)methyl]-6-cyclohexyl-1,3,5-triazin-2-amine.
| Compound Name | 4-[(4-bromophenyl)methyl]-6-cyclohexyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 63868061 |
| Molecular Formula | C16H19BrN4 |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 4-[(4-bromophenyl)methyl]-6-cyclohexyl-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(Cc2ccc(Br)cc2)nc(C2CCCCC2)n1 |
| InChI | InChI=1S/C16H19BrN4/c17-13-8-6-11(7-9-13)10-14-19-15(21-16(18)20-14)12-4-2-1-3-5-12/h6-9,12H,1-5,10H2,(H2,18,19,20,21) |
| InChIKey | JCFWNNYLXXVHLS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |