C8H7ClN4S — CID 83241447
4-chloro-6-(thiophen-2-ylmethyl)-1,3,5-triazin-2-amine (PubChem CID 83241447) has the molecular formula C8H7ClN4S and a molecular weight of 226.69 g/mol. Its IUPAC name is 4-chloro-6-(thiophen-2-ylmethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-(thiophen-2-ylmethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 83241447 |
| Molecular Formula | C8H7ClN4S |
| Molecular Weight | 226.69 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 4-chloro-6-(thiophen-2-ylmethyl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(Cl)nc(Cc2cccs2)n1 |
| InChI | InChI=1S/C8H7ClN4S/c9-7-11-6(12-8(10)13-7)4-5-2-1-3-14-5/h1-3H,4H2,(H2,10,11,12,13) |
| InChIKey | DBBNBEQGTOIKLY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.69 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |