C13H9Cl2N3OS — CID 107050703
3,6-dichloro-2-[3-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 107050703) has the molecular formula C13H9Cl2N3OS and a molecular weight of 326.21 g/mol. Its IUPAC name is 3,6-dichloro-2-[3-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 3,6-dichloro-2-[3-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 107050703 |
| Molecular Formula | C13H9Cl2N3OS |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 324.98 |
| IUPAC Name | 3,6-dichloro-2-[3-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Nc1c(Cl)ccc(Cl)c1-c1nc(Cc2cccs2)no1 |
| InChI | InChI=1S/C13H9Cl2N3OS/c14-8-3-4-9(15)12(16)11(8)13-17-10(18-19-13)6-7-2-1-5-20-7/h1-5H,6,16H2 |
| InChIKey | SZNCYEOMEHGLLI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|