C14H8Cl3N3O — CID 107050440
3,6-dichloro-2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 107050440) has the molecular formula C14H8Cl3N3O and a molecular weight of 340.60 g/mol. Its IUPAC name is 3,6-dichloro-2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 3,6-dichloro-2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 107050440 |
| Molecular Formula | C14H8Cl3N3O |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 3,6-dichloro-2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Nc1c(Cl)ccc(Cl)c1-c1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C14H8Cl3N3O/c15-8-3-1-7(2-4-8)13-19-14(21-20-13)11-9(16)5-6-10(17)12(11)18/h1-6H,18H2 |
| InChIKey | CGTOBHDHKBVYDC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|