C13H9ClN4O — CID 63260076
5-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine (PubChem CID 63260076) has the molecular formula C13H9ClN4O and a molecular weight of 272.70 g/mol. Its IUPAC name is 5-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine.
| Compound Name | 5-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 63260076 |
| Molecular Formula | C13H9ClN4O |
| Molecular Weight | 272.70 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 5-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine |
| SMILES | Nc1ccc(-c2nc(-c3ccc(Cl)cc3)no2)cn1 |
| InChI | InChI=1S/C13H9ClN4O/c14-10-4-1-8(2-5-10)12-17-13(19-18-12)9-3-6-11(15)16-7-9/h1-7H,(H2,15,16) |
| InChIKey | PFVGLVCWHBHICY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.70 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |