C16H26N4S — CID 65144233
4-cyclohexyl-6-(cyclohexylsulfanylmethyl)-1,3,5-triazin-2-amine (PubChem CID 65144233) has the molecular formula C16H26N4S and a molecular weight of 306.48 g/mol. Its IUPAC name is 4-cyclohexyl-6-(cyclohexylsulfanylmethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-cyclohexyl-6-(cyclohexylsulfanylmethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 65144233 |
| Molecular Formula | C16H26N4S |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 4-cyclohexyl-6-(cyclohexylsulfanylmethyl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(CSC2CCCCC2)nc(C2CCCCC2)n1 |
| InChI | InChI=1S/C16H26N4S/c17-16-19-14(11-21-13-9-5-2-6-10-13)18-15(20-16)12-7-3-1-4-8-12/h12-13H,1-11H2,(H2,17,18,19,20) |
| InChIKey | IJSWOUNRTQFGIX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |