C13H19F3N4 — CID 79964959
4-cycloheptyl-6-(3,3,3-trifluoropropyl)-1,3,5-triazin-2-amine (PubChem CID 79964959) has the molecular formula C13H19F3N4 and a molecular weight of 288.32 g/mol. Its IUPAC name is 4-cycloheptyl-6-(3,3,3-trifluoropropyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-cycloheptyl-6-(3,3,3-trifluoropropyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 79964959 |
| Molecular Formula | C13H19F3N4 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 4-cycloheptyl-6-(3,3,3-trifluoropropyl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(CCC(F)(F)F)nc(C2CCCCCC2)n1 |
| InChI | InChI=1S/C13H19F3N4/c14-13(15,16)8-7-10-18-11(20-12(17)19-10)9-5-3-1-2-4-6-9/h9H,1-8H2,(H2,17,18,19,20) |
| InChIKey | RXJPQAFSKNZZNV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |