About 2-pyridin-3-ylacetyl chloride
2-pyridin-3-ylacetyl chloride (PubChem CID 14697475) has the molecular formula C7H6ClNO
and a molecular weight of 155.58 g/mol. Its IUPAC name is 2-pyridin-3-ylacetyl chloride.
Molecular Properties
| Compound Name | 2-pyridin-3-ylacetyl chloride |
| PubChem CID | 14697475 |
| Molecular Formula | C7H6ClNO |
| Molecular Weight | 155.58 g/mol |
| Exact Mass | 155.01 |
| IUPAC Name | 2-pyridin-3-ylacetyl chloride |
| SMILES | O=C(Cl)Cc1cccnc1 |
| InChI | InChI=1S/C7H6ClNO/c8-7(10)4-6-2-1-3-9-5-6/h1-3,5H,4H2 |
| InChIKey | YLVFMHCTUFZMFC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.58 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-pyridin-3-ylacetyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-3-ylacetyl chloride?
The IUPAC name of 2-pyridin-3-ylacetyl chloride (CID 14697475) is 2-pyridin-3-ylacetyl chloride.
What is the SMILES notation for 2-pyridin-3-ylacetyl chloride?
The canonical SMILES for 2-pyridin-3-ylacetyl chloride is O=C(Cl)Cc1cccnc1.
What is the InChIKey of 2-pyridin-3-ylacetyl chloride?
The InChIKey is YLVFMHCTUFZMFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClNO/c8-7(10)4-6-2-1-3-9-5-6/h1-3,5H,4H2.
What are the key properties of 2-pyridin-3-ylacetyl chloride?
2-pyridin-3-ylacetyl chloride has a molecular weight of 155.58 g/mol, XLogP of 1.39, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-3-ylacetyl chloride is sourced from PubChem (CID 14697475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).