About pyridin-3-yl 2-pyridin-3-ylacetate
pyridin-3-yl 2-pyridin-3-ylacetate (PubChem CID 142079829) has the molecular formula C12H10N2O2
and a molecular weight of 214.22 g/mol. Its IUPAC name is pyridin-3-yl 2-pyridin-3-ylacetate.
Molecular Properties
| Compound Name | pyridin-3-yl 2-pyridin-3-ylacetate |
| PubChem CID | 142079829 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | pyridin-3-yl 2-pyridin-3-ylacetate |
| SMILES | O=C(Cc1cccnc1)Oc1cccnc1 |
| InChI | InChI=1S/C12H10N2O2/c15-12(7-10-3-1-5-13-8-10)16-11-4-2-6-14-9-11/h1-6,8-9H,7H2 |
| InChIKey | JRLYKNYPLBTJCM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyridin-3-yl 2-pyridin-3-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-3-yl 2-pyridin-3-ylacetate?
The IUPAC name of pyridin-3-yl 2-pyridin-3-ylacetate (CID 142079829) is pyridin-3-yl 2-pyridin-3-ylacetate.
What is the SMILES notation for pyridin-3-yl 2-pyridin-3-ylacetate?
The canonical SMILES for pyridin-3-yl 2-pyridin-3-ylacetate is O=C(Cc1cccnc1)Oc1cccnc1.
What is the InChIKey of pyridin-3-yl 2-pyridin-3-ylacetate?
The InChIKey is JRLYKNYPLBTJCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O2/c15-12(7-10-3-1-5-13-8-10)16-11-4-2-6-14-9-11/h1-6,8-9H,7H2.
What are the key properties of pyridin-3-yl 2-pyridin-3-ylacetate?
pyridin-3-yl 2-pyridin-3-ylacetate has a molecular weight of 214.22 g/mol, XLogP of 1.62, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-3-yl 2-pyridin-3-ylacetate is sourced from PubChem (CID 142079829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).