C15H17Cl2N3 — CID 105309892
[1-(2,5-dichlorophenyl)-4-pyridin-3-ylbutan-2-yl]hydrazine (PubChem CID 105309892) has the molecular formula C15H17Cl2N3 and a molecular weight of 310.23 g/mol. Its IUPAC name is [1-(2,5-dichlorophenyl)-4-pyridin-3-ylbutan-2-yl]hydrazine.
| Compound Name | [1-(2,5-dichlorophenyl)-4-pyridin-3-ylbutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105309892 |
| Molecular Formula | C15H17Cl2N3 |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | [1-(2,5-dichlorophenyl)-4-pyridin-3-ylbutan-2-yl]hydrazine |
| SMILES | NNC(CCc1cccnc1)Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H17Cl2N3/c16-13-4-6-15(17)12(8-13)9-14(20-18)5-3-11-2-1-7-19-10-11/h1-2,4,6-8,10,14,20H,3,5,9,18H2 |
| InChIKey | NJJLOMNKDOVBRO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|