C18H15Cl2NOS — CID 70510984
2-(2,4-dichlorophenyl)-1-pyridin-3-yl-3-thiophen-2-ylpropan-1-ol (PubChem CID 70510984) has the molecular formula C18H15Cl2NOS and a molecular weight of 364.30 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-pyridin-3-yl-3-thiophen-2-ylpropan-1-ol.
| Compound Name | 2-(2,4-dichlorophenyl)-1-pyridin-3-yl-3-thiophen-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 70510984 |
| Molecular Formula | C18H15Cl2NOS |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-pyridin-3-yl-3-thiophen-2-ylpropan-1-ol |
| SMILES | OC(c1cccnc1)C(Cc1cccs1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H15Cl2NOS/c19-13-5-6-15(17(20)9-13)16(10-14-4-2-8-23-14)18(22)12-3-1-7-21-11-12/h1-9,11,16,18,22H,10H2 |
| InChIKey | KLAXTEIMCTZWDN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |