C14H15Cl2N3S — CID 111026517
1-[1-(2,4-dichlorophenyl)ethyl]-2-(thiophen-2-ylmethyl)guanidine (PubChem CID 111026517) has the molecular formula C14H15Cl2N3S and a molecular weight of 328.27 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111026517 |
| Molecular Formula | C14H15Cl2N3S |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-(thiophen-2-ylmethyl)guanidine |
| SMILES | CC(N/C(N)=N/Cc1cccs1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H15Cl2N3S/c1-9(12-5-4-10(15)7-13(12)16)19-14(17)18-8-11-3-2-6-20-11/h2-7,9H,8H2,1H3,(H3,17,18,19) |
| InChIKey | WAYBHTPSYMRKSG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|