C15H18Cl2N4S — CID 111822136
1-[1-(2,4-dichlorophenyl)ethyl]-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 111822136) has the molecular formula C15H18Cl2N4S and a molecular weight of 357.31 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111822136 |
| Molecular Formula | C15H18Cl2N4S |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | CCc1cnc(C/N=C(\N)NC(C)c2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C15H18Cl2N4S/c1-3-11-7-19-14(22-11)8-20-15(18)21-9(2)12-5-4-10(16)6-13(12)17/h4-7,9H,3,8H2,1-2H3,(H3,18,20,21) |
| InChIKey | VFIWJPXSWKBKMD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|