C15H17Cl2N5S — CID 122099364
2-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-1-[1-(2,4-dichlorophenyl)ethyl]guanidine (PubChem CID 122099364) has the molecular formula C15H17Cl2N5S and a molecular weight of 370.31 g/mol. Its IUPAC name is 2-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-1-[1-(2,4-dichlorophenyl)ethyl]guanidine.
| Compound Name | 2-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-1-[1-(2,4-dichlorophenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 122099364 |
| Molecular Formula | C15H17Cl2N5S |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 2-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-1-[1-(2,4-dichlorophenyl)ethyl]guanidine |
| SMILES | CC(N/C(N)=N/Cc1nnc(C2CC2)s1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H17Cl2N5S/c1-8(11-5-4-10(16)6-12(11)17)20-15(18)19-7-13-21-22-14(23-13)9-2-3-9/h4-6,8-9H,2-3,7H2,1H3,(H3,18,19,20) |
| InChIKey | YMCVGMUBVCUWAF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|