C19H25Cl2IN4 — CID 111034522
1-[1-(2,4-dichlorophenyl)ethyl]-2-[[2-[(dimethylamino)methyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 111034522) has the molecular formula C19H25Cl2IN4 and a molecular weight of 507.25 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[[2-[(dimethylamino)methyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[[2-[(dimethylamino)methyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111034522 |
| Molecular Formula | C19H25Cl2IN4 |
| Molecular Weight | 507.25 g/mol |
| Exact Mass | 506.05 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[[2-[(dimethylamino)methyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | CC(N/C(N)=N/Cc1ccccc1CN(C)C)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C19H24Cl2N4.HI/c1-13(17-9-8-16(20)10-18(17)21)24-19(22)23-11-14-6-4-5-7-15(14)12-25(2)3;/h4-10,13H,11-12H2,1-3H3,(H3,22,23,24);1H |
| InChIKey | ZTYPVIZEIXWVJW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.25 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|