C17H16Cl2FIN4 — CID 111821556
2-[(5-cyano-2-fluorophenyl)methyl]-1-[1-(2,4-dichlorophenyl)ethyl]guanidine;hydroiodide (PubChem CID 111821556) has the molecular formula C17H16Cl2FIN4 and a molecular weight of 493.15 g/mol. Its IUPAC name is 2-[(5-cyano-2-fluorophenyl)methyl]-1-[1-(2,4-dichlorophenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[(5-cyano-2-fluorophenyl)methyl]-1-[1-(2,4-dichlorophenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111821556 |
| Molecular Formula | C17H16Cl2FIN4 |
| Molecular Weight | 493.15 g/mol |
| Exact Mass | 491.98 |
| IUPAC Name | 2-[(5-cyano-2-fluorophenyl)methyl]-1-[1-(2,4-dichlorophenyl)ethyl]guanidine;hydroiodide |
| SMILES | CC(N/C(N)=N/Cc1cc(C#N)ccc1F)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C17H15Cl2FN4.HI/c1-10(14-4-3-13(18)7-15(14)19)24-17(22)23-9-12-6-11(8-21)2-5-16(12)20;/h2-7,10H,9H2,1H3,(H3,22,23,24);1H |
| InChIKey | HIIAGUIPCVRFGN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.15 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|