C17H28Cl2IN3O — CID 111822946
1-[1-(2,4-dichlorophenyl)ethyl]-2-(2,2-diethyl-4-hydroxybutyl)guanidine;hydroiodide (PubChem CID 111822946) has the molecular formula C17H28Cl2IN3O and a molecular weight of 488.24 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-(2,2-diethyl-4-hydroxybutyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-(2,2-diethyl-4-hydroxybutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111822946 |
| Molecular Formula | C17H28Cl2IN3O |
| Molecular Weight | 488.24 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-(2,2-diethyl-4-hydroxybutyl)guanidine;hydroiodide |
| SMILES | CCC(CC)(CCO)C/N=C(\N)NC(C)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C17H27Cl2N3O.HI/c1-4-17(5-2,8-9-23)11-21-16(20)22-12(3)14-7-6-13(18)10-15(14)19;/h6-7,10,12,23H,4-5,8-9,11H2,1-3H3,(H3,20,21,22);1H |
| InChIKey | MCLYMKOBGXZWPA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.24 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|