C16H20Cl2IN5 — CID 120913701
1-[1-(2,4-dichlorophenyl)ethyl]-2-[(2,6-dimethylpyrimidin-4-yl)methyl]guanidine;hydroiodide (PubChem CID 120913701) has the molecular formula C16H20Cl2IN5 and a molecular weight of 480.18 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(2,6-dimethylpyrimidin-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(2,6-dimethylpyrimidin-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 120913701 |
| Molecular Formula | C16H20Cl2IN5 |
| Molecular Weight | 480.18 g/mol |
| Exact Mass | 479.01 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(2,6-dimethylpyrimidin-4-yl)methyl]guanidine;hydroiodide |
| SMILES | Cc1cc(C/N=C(\N)NC(C)c2ccc(Cl)cc2Cl)nc(C)n1.I |
| InChI | InChI=1S/C16H19Cl2N5.HI/c1-9-6-13(23-11(3)21-9)8-20-16(19)22-10(2)14-5-4-12(17)7-15(14)18;/h4-7,10H,8H2,1-3H3,(H3,19,20,22);1H |
| InChIKey | SUVHLLYKBFVXJX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.18 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|