C16H19Cl2IN4 — CID 111802421
1-[1-(2,4-dichlorophenyl)ethyl]-2-[(3-methyl-2-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 111802421) has the molecular formula C16H19Cl2IN4 and a molecular weight of 465.17 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(3-methyl-2-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(3-methyl-2-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111802421 |
| Molecular Formula | C16H19Cl2IN4 |
| Molecular Weight | 465.17 g/mol |
| Exact Mass | 464.00 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(3-methyl-2-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | Cc1cccnc1C/N=C(\N)NC(C)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C16H18Cl2N4.HI/c1-10-4-3-7-20-15(10)9-21-16(19)22-11(2)13-6-5-12(17)8-14(13)18;/h3-8,11H,9H2,1-2H3,(H3,19,21,22);1H |
| InChIKey | DJUQJQSOOMWASU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.17 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|