C17H21Cl2N5 — CID 111055923
1-[1-(2,4-dichlorophenyl)ethyl]-2-[[2-(dimethylamino)-4-pyridinyl]methyl]guanidine (PubChem CID 111055923) has the molecular formula C17H21Cl2N5 and a molecular weight of 366.30 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[[2-(dimethylamino)-4-pyridinyl]methyl]guanidine.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[[2-(dimethylamino)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111055923 |
| Molecular Formula | C17H21Cl2N5 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[[2-(dimethylamino)-4-pyridinyl]methyl]guanidine |
| SMILES | CC(N/C(N)=N/Cc1ccnc(N(C)C)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H21Cl2N5/c1-11(14-5-4-13(18)9-15(14)19)23-17(20)22-10-12-6-7-21-16(8-12)24(2)3/h4-9,11H,10H2,1-3H3,(H3,20,22,23) |
| InChIKey | JVLHXUYPDWMPSB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|