C20H25Cl2IN4O2 — CID 111047851
2-[3-[[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]methyl]phenoxy]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111047851) has the molecular formula C20H25Cl2IN4O2 and a molecular weight of 551.26 g/mol. Its IUPAC name is 2-[3-[[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]methyl]phenoxy]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[3-[[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]methyl]phenoxy]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111047851 |
| Molecular Formula | C20H25Cl2IN4O2 |
| Molecular Weight | 551.26 g/mol |
| Exact Mass | 550.04 |
| IUPAC Name | 2-[3-[[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]methyl]phenoxy]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CC(N/C(N)=N/Cc1cccc(OCC(=O)N(C)C)c1)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C20H24Cl2N4O2.HI/c1-13(17-8-7-15(21)10-18(17)22)25-20(23)24-11-14-5-4-6-16(9-14)28-12-19(27)26(2)3;/h4-10,13H,11-12H2,1-3H3,(H3,23,24,25);1H |
| InChIKey | FJUSCOGGCDOIMV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.26 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|