C20H23F3N4O3 — CID 111598362
2-[3-[[[amino-[[4-(trifluoromethoxy)phenyl]methylamino]methylidene]amino]methyl]phenoxy]-N,N-dimethylacetamide (PubChem CID 111598362) has the molecular formula C20H23F3N4O3 and a molecular weight of 424.42 g/mol. Its IUPAC name is 2-[3-[[[amino-[[4-(trifluoromethoxy)phenyl]methylamino]methylidene]amino]methyl]phenoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[3-[[[amino-[[4-(trifluoromethoxy)phenyl]methylamino]methylidene]amino]methyl]phenoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111598362 |
| Molecular Formula | C20H23F3N4O3 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 2-[3-[[[amino-[[4-(trifluoromethoxy)phenyl]methylamino]methylidene]amino]methyl]phenoxy]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)COc1cccc(C/N=C(\N)NCc2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C20H23F3N4O3/c1-27(2)18(28)13-29-17-5-3-4-15(10-17)12-26-19(24)25-11-14-6-8-16(9-7-14)30-20(21,22)23/h3-10H,11-13H2,1-2H3,(H3,24,25,26) |
| InChIKey | VCEWQQSJJZLMKD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|