C17H18F3N3O2 — CID 111597480
2-[(4-methoxyphenyl)methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine (PubChem CID 111597480) has the molecular formula C17H18F3N3O2 and a molecular weight of 353.34 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111597480 |
| Molecular Formula | C17H18F3N3O2 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine |
| SMILES | COc1ccc(C/N=C(\N)NCc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H18F3N3O2/c1-24-14-6-2-12(3-7-14)10-22-16(21)23-11-13-4-8-15(9-5-13)25-17(18,19)20/h2-9H,10-11H2,1H3,(H3,21,22,23) |
| InChIKey | HKMPWYOJSUVUOK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|