C22H22F3IN4O3 — CID 111598481
2-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111598481) has the molecular formula C22H22F3IN4O3 and a molecular weight of 574.34 g/mol. Its IUPAC name is 2-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111598481 |
| Molecular Formula | C22H22F3IN4O3 |
| Molecular Weight | 574.34 g/mol |
| Exact Mass | 574.07 |
| IUPAC Name | 2-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | COc1cccc(Oc2ccc(C/N=C(\N)NCc3ccc(OC(F)(F)F)cc3)cn2)c1.I |
| InChI | InChI=1S/C22H21F3N4O3.HI/c1-30-18-3-2-4-19(11-18)31-20-10-7-16(13-27-20)14-29-21(26)28-12-15-5-8-17(9-6-15)32-22(23,24)25;/h2-11,13H,12,14H2,1H3,(H3,26,28,29);1H |
| InChIKey | SRVOMMKUJYUASY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.34 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|