C21H27F3N6O — CID 111598558
2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine (PubChem CID 111598558) has the molecular formula C21H27F3N6O and a molecular weight of 436.48 g/mol. Its IUPAC name is 2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine.
| Compound Name | 2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111598558 |
| Molecular Formula | C21H27F3N6O |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine |
| SMILES | CCN1CCN(c2ccc(C/N=C(\N)NCc3ccc(OC(F)(F)F)cc3)cn2)CC1 |
| InChI | InChI=1S/C21H27F3N6O/c1-2-29-9-11-30(12-10-29)19-8-5-17(14-26-19)15-28-20(25)27-13-16-3-6-18(7-4-16)31-21(22,23)24/h3-8,14H,2,9-13,15H2,1H3,(H3,25,27,28) |
| InChIKey | GSBKGEDCUIPENB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 79.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|