C19H23F3IN5O2 — CID 111049301
2-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide (PubChem CID 111049301) has the molecular formula C19H23F3IN5O2 and a molecular weight of 537.32 g/mol. Its IUPAC name is 2-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide.
| Compound Name | 2-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111049301 |
| Molecular Formula | C19H23F3IN5O2 |
| Molecular Weight | 537.32 g/mol |
| Exact Mass | 537.08 |
| IUPAC Name | 2-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
| SMILES | CC1CN(c2ccc(C/N=C(\N)Nc3ccc(OC(F)(F)F)cc3)cn2)CCO1.I |
| InChI | InChI=1S/C19H22F3N5O2.HI/c1-13-12-27(8-9-28-13)17-7-2-14(10-24-17)11-25-18(23)26-15-3-5-16(6-4-15)29-19(20,21)22;/h2-7,10,13H,8-9,11-12H2,1H3,(H3,23,25,26);1H |
| InChIKey | VANFCYHHLDELRC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|