C24H27N5O2 — CID 111598422
2-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-1-(3-phenoxyphenyl)guanidine (PubChem CID 111598422) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-1-(3-phenoxyphenyl)guanidine.
| Compound Name | 2-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-1-(3-phenoxyphenyl)guanidine |
|---|---|
| PubChem CID | 111598422 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 2-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-1-(3-phenoxyphenyl)guanidine |
| SMILES | CC1CN(c2ccc(C/N=C(\N)Nc3cccc(Oc4ccccc4)c3)cn2)CCO1 |
| InChI | InChI=1S/C24H27N5O2/c1-18-17-29(12-13-30-18)23-11-10-19(15-26-23)16-27-24(25)28-20-6-5-9-22(14-20)31-21-7-3-2-4-8-21/h2-11,14-15,18H,12-13,16-17H2,1H3,(H3,25,27,28) |
| InChIKey | IZNSTNRVMPDSBQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|